C23H28ClN5O4 — CID 142041912
(6Z)-6-[(2-chloro-1-methoxy-2,3-dihydroindol-3-yl)methylidene]-2-methylidene-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione (PubChem CID 142041912) has the molecular formula C23H28ClN5O4 and a molecular weight of 473.96 g/mol. Its IUPAC name is (6Z)-6-[(2-chloro-1-methoxy-2,3-dihydroindol-3-yl)methylidene]-2-methylidene-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione.
| Compound Name | (6Z)-6-[(2-chloro-1-methoxy-2,3-dihydroindol-3-yl)methylidene]-2-methylidene-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione |
|---|---|
| PubChem CID | 142041912 |
| Molecular Formula | C23H28ClN5O4 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | (6Z)-6-[(2-chloro-1-methoxy-2,3-dihydroindol-3-yl)methylidene]-2-methylidene-1,4,7,10-tetrazabicyclo[10.4.0]hexadecane-5,8,11-trione |
| SMILES | C=C1CNC(=O)/C(=C/C2c3ccccc3N(OC)C2Cl)NC(=O)CNC(=O)C2CCCCN12 |
| InChI | InChI=1S/C23H28ClN5O4/c1-14-12-25-22(31)17(11-16-15-7-3-4-8-18(15)29(33-2)21(16)24)27-20(30)13-26-23(32)19-9-5-6-10-28(14)19/h3-4,7-8,11,16,19,21H,1,5-6,9-10,12-13H2,2H3,(H,25,31)(H,26,32)(H,27,30)/b17-11- |
| InChIKey | OSXCDJKFWCLAPY-BOPFTXTBSA-N |
| XLogP | 1.33 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|