C24H26N4 — CID 142042013
4-[(8S)-3-methyl-8-(3-phenylpropylamino)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl]benzonitrile (PubChem CID 142042013) has the molecular formula C24H26N4 and a molecular weight of 370.50 g/mol. Its IUPAC name is 4-[(8S)-3-methyl-8-(3-phenylpropylamino)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl]benzonitrile.
| Compound Name | 4-[(8S)-3-methyl-8-(3-phenylpropylamino)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 142042013 |
| Molecular Formula | C24H26N4 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 4-[(8S)-3-methyl-8-(3-phenylpropylamino)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-yl]benzonitrile |
| SMILES | Cc1ncc2n1C(c1ccc(C#N)cc1)CC[C@@H]2NCCCc1ccccc1 |
| InChI | InChI=1S/C24H26N4/c1-18-27-17-24-22(26-15-5-8-19-6-3-2-4-7-19)13-14-23(28(18)24)21-11-9-20(16-25)10-12-21/h2-4,6-7,9-12,17,22-23,26H,5,8,13-15H2,1H3/t22-,23?/m0/s1 |
| InChIKey | HSTLEKHNSJOSPM-NQCNTLBGSA-N |
| XLogP | 4.71 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|