C30H53NO3S — CID 142042070
ethane;(E)-3-methoxy-4,4,6,8,12,16-hexamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxoheptadec-16-enal (PubChem CID 142042070) has the molecular formula C30H53NO3S and a molecular weight of 507.83 g/mol. Its IUPAC name is ethane;(E)-3-methoxy-4,4,6,8,12,16-hexamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxoheptadec-16-enal.
| Compound Name | ethane;(E)-3-methoxy-4,4,6,8,12,16-hexamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxoheptadec-16-enal |
|---|---|
| PubChem CID | 142042070 |
| Molecular Formula | C30H53NO3S |
| Molecular Weight | 507.83 g/mol |
| Exact Mass | 507.37 |
| IUPAC Name | ethane;(E)-3-methoxy-4,4,6,8,12,16-hexamethyl-17-(2-methyl-1,3-thiazol-4-yl)-5-oxoheptadec-16-enal |
| SMILES | CC.COC(CC=O)C(C)(C)C(=O)C(C)CC(C)CCCC(C)CCC/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C28H47NO3S.C2H6/c1-20(12-10-14-22(3)18-25-19-33-24(5)29-25)11-9-13-21(2)17-23(4)27(31)28(6,7)26(32-8)15-16-30;1-2/h16,18-21,23,26H,9-15,17H2,1-8H3;1-2H3/b22-18+; |
| InChIKey | HQIHBPBALWKBRB-MLWJBJAVSA-N |
| XLogP | 8.72 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.83 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|