C12H8N2O2 — CID 142042222
6-methoxypyrido[3,4-b]indol-1-one (PubChem CID 142042222) has the molecular formula C12H8N2O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is 6-methoxypyrido[3,4-b]indol-1-one.
| Compound Name | 6-methoxypyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 142042222 |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 6-methoxypyrido[3,4-b]indol-1-one |
| SMILES | COc1ccc2c(c1)C1=CC=NC(=O)C1=N2 |
| InChI | InChI=1S/C12H8N2O2/c1-16-7-2-3-10-9(6-7)8-4-5-13-12(15)11(8)14-10/h2-6H,1H3 |
| InChIKey | GJJWRPZPEAAIMH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |