C15H18S3 — CID 142042375
5-[(1E,3E)-4-cyclohexa-1,3-dien-1-ylbuta-1,3-dienyl]dithiole-3-thione;ethane (PubChem CID 142042375) has the molecular formula C15H18S3 and a molecular weight of 294.51 g/mol. Its IUPAC name is 5-[(1E,3E)-4-cyclohexa-1,3-dien-1-ylbuta-1,3-dienyl]dithiole-3-thione;ethane.
| Compound Name | 5-[(1E,3E)-4-cyclohexa-1,3-dien-1-ylbuta-1,3-dienyl]dithiole-3-thione;ethane |
|---|---|
| PubChem CID | 142042375 |
| Molecular Formula | C15H18S3 |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 5-[(1E,3E)-4-cyclohexa-1,3-dien-1-ylbuta-1,3-dienyl]dithiole-3-thione;ethane |
| SMILES | CC.S=c1cc(/C=C/C=C/C2=CC=CCC2)ss1 |
| InChI | InChI=1S/C13H12S3.C2H6/c14-13-10-12(15-16-13)9-5-4-8-11-6-2-1-3-7-11;1-2/h1-2,4-6,8-10H,3,7H2;1-2H3/b8-4+,9-5+; |
| InChIKey | RCWGEHIVIWOXAY-VYMJFYGFSA-N |
| XLogP | 6.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|