C30H39FN4O4S — CID 142042673
2-amino-6-[[(3Z,5Z)-3-fluorohepta-1,3,5-trien-4-yl]sulfonylamino]-N-[6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide (PubChem CID 142042673) has the molecular formula C30H39FN4O4S and a molecular weight of 570.73 g/mol. Its IUPAC name is 2-amino-6-[[(3Z,5Z)-3-fluorohepta-1,3,5-trien-4-yl]sulfonylamino]-N-[6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide.
| Compound Name | 2-amino-6-[[(3Z,5Z)-3-fluorohepta-1,3,5-trien-4-yl]sulfonylamino]-N-[6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide |
|---|---|
| PubChem CID | 142042673 |
| Molecular Formula | C30H39FN4O4S |
| Molecular Weight | 570.73 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | 2-amino-6-[[(3Z,5Z)-3-fluorohepta-1,3,5-trien-4-yl]sulfonylamino]-N-[6-methoxy-1-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydronaphthalen-2-yl]hexanamide |
| SMILES | C=C/C(F)=C(\C=C/C)S(=O)(=O)NCCCCC(N)C(=O)NC1CCc2cc(OC)ccc2C1Cc1cccnc1 |
| InChI | InChI=1S/C30H39FN4O4S/c1-4-9-29(26(31)5-2)40(37,38)34-17-7-6-11-27(32)30(36)35-28-15-12-22-19-23(39-3)13-14-24(22)25(28)18-21-10-8-16-33-20-21/h4-5,8-10,13-14,16,19-20,25,27-28,34H,2,6-7,11-12,15,17-18,32H2,1,3H3,(H,35,36)/b9-4-,29-26- |
| InChIKey | JRVGKGHSTLBHET-NWKXMXCMSA-N |
| XLogP | 4.21 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.73 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|