C44H13Cl17N4 — CID 142043126
2,3,5,7,8,10,12,13,23-nonachloro-15,17,18,20-tetrakis(2,6-dichlorophenyl)-21H-porphyrin (PubChem CID 142043126) has the molecular formula C44H13Cl17N4 and a molecular weight of 1200.32 g/mol. Its IUPAC name is 2,3,5,7,8,10,12,13,23-nonachloro-15,17,18,20-tetrakis(2,6-dichlorophenyl)-21H-porphyrin.
| Compound Name | 2,3,5,7,8,10,12,13,23-nonachloro-15,17,18,20-tetrakis(2,6-dichlorophenyl)-21H-porphyrin |
|---|---|
| PubChem CID | 142043126 |
| Molecular Formula | C44H13Cl17N4 |
| Molecular Weight | 1200.32 g/mol |
| Exact Mass | 1191.58 |
| IUPAC Name | 2,3,5,7,8,10,12,13,23-nonachloro-15,17,18,20-tetrakis(2,6-dichlorophenyl)-21H-porphyrin |
| SMILES | ClC1=C(Cl)c2nc1c(Cl)c1[nH]c(c(Cl)c1Cl)c(-c1c(Cl)cccc1Cl)c1nc(c(-c3c(Cl)cccc3Cl)c3c(Cl)c(Cl)c(c2Cl)n3Cl)C(c2c(Cl)cccc2Cl)=C1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C44H13Cl17N4/c45-13-5-1-6-14(46)21(13)25-26(22-15(47)7-2-8-16(22)48)38-28(24-19(51)11-4-12-20(24)52)43-33(57)34(58)44(65(43)61)36(60)42-32(56)31(55)41(64-42)35(59)40-30(54)29(53)39(63-40)27(37(25)62-38)23-17(49)9-3-10-18(23)50/h1-12,63H/b37-27-,38-28-,39-27-,40-35+,41-35+,42-36+,43-28-,44-36+ |
| InChIKey | KFNPSDWXPPROBZ-OYPJXDIBSA-N |
| XLogP | 21.58 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1200.32 |
| LogP ≤ 5 | 21.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|