C32H28F2 — CID 142043259
1-fluoro-2,7-dimethyl-9,10-dihydrophenanthrene;3-fluoro-2,7-dimethylphenanthrene (PubChem CID 142043259) has the molecular formula C32H28F2 and a molecular weight of 450.57 g/mol. Its IUPAC name is 1-fluoro-2,7-dimethyl-9,10-dihydrophenanthrene;3-fluoro-2,7-dimethylphenanthrene.
| Compound Name | 1-fluoro-2,7-dimethyl-9,10-dihydrophenanthrene;3-fluoro-2,7-dimethylphenanthrene |
|---|---|
| PubChem CID | 142043259 |
| Molecular Formula | C32H28F2 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 1-fluoro-2,7-dimethyl-9,10-dihydrophenanthrene;3-fluoro-2,7-dimethylphenanthrene |
| SMILES | Cc1ccc2c(c1)CCc1c-2ccc(C)c1F.Cc1ccc2c(ccc3cc(C)c(F)cc32)c1 |
| InChI | InChI=1S/C16H15F.C16H13F/c1-10-3-6-13-12(9-10)5-8-15-14(13)7-4-11(2)16(15)17;1-10-3-6-14-12(7-10)4-5-13-8-11(2)16(17)9-15(13)14/h3-4,6-7,9H,5,8H2,1-2H3;3-9H,1-2H3 |
| InChIKey | WDJTUSCEEGYIRS-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|