About 2-methoxy-N-[5-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]pentyl]acetamide;2-methylpropane
2-methoxy-N-[5-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]pentyl]acetamide;2-methylpropane (PubChem CID 142043656) has the molecular formula C18H38N2O4
and a molecular weight of 346.51 g/mol. Its IUPAC name is 2-methoxy-N-[5-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]pentyl]acetamide;2-methylpropane.
Molecular Properties
| Compound Name | 2-methoxy-N-[5-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]pentyl]acetamide;2-methylpropane |
| PubChem CID | 142043656 |
| Molecular Formula | C18H38N2O4 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.28 |
| IUPAC Name | 2-methoxy-N-[5-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]pentyl]acetamide;2-methylpropane |
| SMILES | CC(C)C.COCC(=O)NCCCCCNC(=O)COC(C)(C)C |
| InChI | InChI=1S/C14H28N2O4.C4H10/c1-14(2,3)20-11-13(18)16-9-7-5-6-8-15-12(17)10-19-4;1-4(2)3/h5-11H2,1-4H3,(H,15,17)(H,16,18);4H,1-3H3 |
| InChIKey | SYHKTVLZPZKJCV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-N-[5-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]pentyl]acetamide;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N-[5-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]pentyl]acetamide;2-methylpropane?
The IUPAC name of 2-methoxy-N-[5-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]pentyl]acetamide;2-methylpropane (CID 142043656) is 2-methoxy-N-[5-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]pentyl]acetamide;2-methylpropane.
What is the SMILES notation for 2-methoxy-N-[5-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]pentyl]acetamide;2-methylpropane?
The canonical SMILES for 2-methoxy-N-[5-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]pentyl]acetamide;2-methylpropane is CC(C)C.COCC(=O)NCCCCCNC(=O)COC(C)(C)C.
What is the InChIKey of 2-methoxy-N-[5-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]pentyl]acetamide;2-methylpropane?
The InChIKey is SYHKTVLZPZKJCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O4.C4H10/c1-14(2,3)20-11-13(18)16-9-7-5-6-8-15-12(17)10-19-4;1-4(2)3/h5-11H2,1-4H3,(H,15,17)(H,16,18);4H,1-3H3.
What are the key properties of 2-methoxy-N-[5-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]pentyl]acetamide;2-methylpropane?
2-methoxy-N-[5-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]pentyl]acetamide;2-methylpropane has a molecular weight of 346.51 g/mol, XLogP of 2.51, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N-[5-[[2-[(2-methylpropan-2-yl)oxy]acetyl]amino]pentyl]acetamide;2-methylpropane is sourced from PubChem (CID 142043656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).