About 4-methyl-3,4-dihydroquinoline-5,8-dione
4-methyl-3,4-dihydroquinoline-5,8-dione (PubChem CID 142044441) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is 4-methyl-3,4-dihydroquinoline-5,8-dione.
Molecular Properties
| Compound Name | 4-methyl-3,4-dihydroquinoline-5,8-dione |
| PubChem CID | 142044441 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 4-methyl-3,4-dihydroquinoline-5,8-dione |
| SMILES | CC1CC=NC2=C1C(=O)C=CC2=O |
| InChI | InChI=1S/C10H9NO2/c1-6-4-5-11-10-8(13)3-2-7(12)9(6)10/h2-3,5-6H,4H2,1H3 |
| InChIKey | UCFICEAPDMSGDL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3,4-dihydroquinoline-5,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3,4-dihydroquinoline-5,8-dione?
The IUPAC name of 4-methyl-3,4-dihydroquinoline-5,8-dione (CID 142044441) is 4-methyl-3,4-dihydroquinoline-5,8-dione.
What is the SMILES notation for 4-methyl-3,4-dihydroquinoline-5,8-dione?
The canonical SMILES for 4-methyl-3,4-dihydroquinoline-5,8-dione is CC1CC=NC2=C1C(=O)C=CC2=O.
What is the InChIKey of 4-methyl-3,4-dihydroquinoline-5,8-dione?
The InChIKey is UCFICEAPDMSGDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c1-6-4-5-11-10-8(13)3-2-7(12)9(6)10/h2-3,5-6H,4H2,1H3.
What are the key properties of 4-methyl-3,4-dihydroquinoline-5,8-dione?
4-methyl-3,4-dihydroquinoline-5,8-dione has a molecular weight of 175.19 g/mol, XLogP of 1.06, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3,4-dihydroquinoline-5,8-dione is sourced from PubChem (CID 142044441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).