About 3-(3,5-dichlorophenyl)-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid
3-(3,5-dichlorophenyl)-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid (PubChem CID 142045142) has the molecular formula C24H24Cl2N2O3
and a molecular weight of 459.37 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid.
Molecular Properties
| Compound Name | 3-(3,5-dichlorophenyl)-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid |
| PubChem CID | 142045142 |
| Molecular Formula | C24H24Cl2N2O3 |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid |
| SMILES | O=C(O)CC(Cc1ccc(OCCCNc2ccccn2)cc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C24H24Cl2N2O3/c25-20-13-19(14-21(26)16-20)18(15-24(29)30)12-17-5-7-22(8-6-17)31-11-3-10-28-23-4-1-2-9-27-23/h1-2,4-9,13-14,16,18H,3,10-12,15H2,(H,27,28)(H,29,30) |
| InChIKey | JPAFHYXWIVASQI-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dichlorophenyl)-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dichlorophenyl)-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid?
The IUPAC name of 3-(3,5-dichlorophenyl)-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid (CID 142045142) is 3-(3,5-dichlorophenyl)-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid.
What is the SMILES notation for 3-(3,5-dichlorophenyl)-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid?
The canonical SMILES for 3-(3,5-dichlorophenyl)-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid is O=C(O)CC(Cc1ccc(OCCCNc2ccccn2)cc1)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of 3-(3,5-dichlorophenyl)-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid?
The InChIKey is JPAFHYXWIVASQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24Cl2N2O3/c25-20-13-19(14-21(26)16-20)18(15-24(29)30)12-17-5-7-22(8-6-17)31-11-3-10-28-23-4-1-2-9-27-23/h1-2,4-9,13-14,16,18H,3,10-12,15H2,(H,27,28)(H,29,30).
What are the key properties of 3-(3,5-dichlorophenyl)-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid?
3-(3,5-dichlorophenyl)-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid has a molecular weight of 459.37 g/mol, XLogP of 6.07, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dichlorophenyl)-4-[4-[3-(pyridin-2-ylamino)propoxy]phenyl]butanoic acid is sourced from PubChem (CID 142045142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).