C20H33NO3S — CID 142045662
17-hydroxy-10,13-dimethyl-11-(methylaminosulfanyloxy)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 142045662) has the molecular formula C20H33NO3S and a molecular weight of 367.56 g/mol. Its IUPAC name is 17-hydroxy-10,13-dimethyl-11-(methylaminosulfanyloxy)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 17-hydroxy-10,13-dimethyl-11-(methylaminosulfanyloxy)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 142045662 |
| Molecular Formula | C20H33NO3S |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | 17-hydroxy-10,13-dimethyl-11-(methylaminosulfanyloxy)-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CNSOC1CC2(C)C(O)CCC2C2CCC3CC(=O)CCC3(C)C12 |
| InChI | InChI=1S/C20H33NO3S/c1-19-9-8-13(22)10-12(19)4-5-14-15-6-7-17(23)20(15,2)11-16(18(14)19)24-25-21-3/h12,14-18,21,23H,4-11H2,1-3H3 |
| InChIKey | ITAONZMFPLRLAN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|