C15H27F5OS — CID 142045722
10-(4,4,5,5,5-pentafluoropentylsulfanyl)decan-1-ol (PubChem CID 142045722) has the molecular formula C15H27F5OS and a molecular weight of 350.44 g/mol. Its IUPAC name is 10-(4,4,5,5,5-pentafluoropentylsulfanyl)decan-1-ol.
| Compound Name | 10-(4,4,5,5,5-pentafluoropentylsulfanyl)decan-1-ol |
|---|---|
| PubChem CID | 142045722 |
| Molecular Formula | C15H27F5OS |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 10-(4,4,5,5,5-pentafluoropentylsulfanyl)decan-1-ol |
| SMILES | OCCCCCCCCCCSCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H27F5OS/c16-14(17,15(18,19)20)10-9-13-22-12-8-6-4-2-1-3-5-7-11-21/h21H,1-13H2 |
| InChIKey | QTUDXHREYSNRDM-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|