C21H22N4 — CID 142047602
7-(2-ethylphenyl)-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-5-amine (PubChem CID 142047602) has the molecular formula C21H22N4 and a molecular weight of 330.44 g/mol. Its IUPAC name is 7-(2-ethylphenyl)-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-5-amine.
| Compound Name | 7-(2-ethylphenyl)-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-5-amine |
|---|---|
| PubChem CID | 142047602 |
| Molecular Formula | C21H22N4 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 7-(2-ethylphenyl)-2-[(2E,4Z)-hepta-2,4,6-trien-2-yl]-[1,2,4]triazolo[1,5-a]pyridin-5-amine |
| SMILES | C=C/C=C\C=C(/C)c1nc2cc(-c3ccccc3CC)cc(N)n2n1 |
| InChI | InChI=1S/C21H22N4/c1-4-6-7-10-15(3)21-23-20-14-17(13-19(22)25(20)24-21)18-12-9-8-11-16(18)5-2/h4,6-14H,1,5,22H2,2-3H3/b7-6-,15-10+ |
| InChIKey | ZYNDANJDHOPETF-GZJRMXIGSA-N |
| XLogP | 4.69 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|