C23H28F2N2 — CID 142047645
(E,3E)-N-[4-[3-(1,1-difluoroethyl)phenyl]-6-methyl-2H-pyridin-1-yl]-3,6-dimethylhepta-3,5-dien-2-imine (PubChem CID 142047645) has the molecular formula C23H28F2N2 and a molecular weight of 370.49 g/mol. Its IUPAC name is (E,3E)-N-[4-[3-(1,1-difluoroethyl)phenyl]-6-methyl-2H-pyridin-1-yl]-3,6-dimethylhepta-3,5-dien-2-imine.
| Compound Name | (E,3E)-N-[4-[3-(1,1-difluoroethyl)phenyl]-6-methyl-2H-pyridin-1-yl]-3,6-dimethylhepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 142047645 |
| Molecular Formula | C23H28F2N2 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | (E,3E)-N-[4-[3-(1,1-difluoroethyl)phenyl]-6-methyl-2H-pyridin-1-yl]-3,6-dimethylhepta-3,5-dien-2-imine |
| SMILES | CC(C)=C/C=C(C)/C(C)=N/N1CC=C(c2cccc(C(C)(F)F)c2)C=C1C |
| InChI | InChI=1S/C23H28F2N2/c1-16(2)10-11-17(3)19(5)26-27-13-12-21(14-18(27)4)20-8-7-9-22(15-20)23(6,24)25/h7-12,14-15H,13H2,1-6H3/b17-11+,26-19+ |
| InChIKey | XCVLBRWGTXMXFT-YVVVRAHLSA-N |
| XLogP | 6.69 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|