About (5Z)-N,N-dimethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-amine;ethane;ethene
(5Z)-N,N-dimethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-amine;ethane;ethene (PubChem CID 142048312) has the molecular formula C17H33N
and a molecular weight of 251.46 g/mol. Its IUPAC name is (5Z)-N,N-dimethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-amine;ethane;ethene.
Molecular Properties
| Compound Name | (5Z)-N,N-dimethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-amine;ethane;ethene |
| PubChem CID | 142048312 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | (5Z)-N,N-dimethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-amine;ethane;ethene |
| SMILES | C=C.C=C/C=C(\C=C/C)CCC(C)N(C)C.CC |
| InChI | InChI=1S/C13H23N.C2H6.C2H4/c1-6-8-13(9-7-2)11-10-12(3)14(4)5;2*1-2/h6-9,12H,1,10-11H2,2-5H3;1-2H3;1-2H2/b9-7-,13-8+;; |
| InChIKey | STBRJYIRCYSMJC-KDLXQMMSSA-N |
| XLogP | 5.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-N,N-dimethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-amine;ethane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-N,N-dimethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-amine;ethane;ethene?
The IUPAC name of (5Z)-N,N-dimethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-amine;ethane;ethene (CID 142048312) is (5Z)-N,N-dimethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-amine;ethane;ethene.
What is the SMILES notation for (5Z)-N,N-dimethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-amine;ethane;ethene?
The canonical SMILES for (5Z)-N,N-dimethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-amine;ethane;ethene is C=C.C=C/C=C(\C=C/C)CCC(C)N(C)C.CC.
What is the InChIKey of (5Z)-N,N-dimethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-amine;ethane;ethene?
The InChIKey is STBRJYIRCYSMJC-KDLXQMMSSA-N. The full InChI is InChI=1S/C13H23N.C2H6.C2H4/c1-6-8-13(9-7-2)11-10-12(3)14(4)5;2*1-2/h6-9,12H,1,10-11H2,2-5H3;1-2H3;1-2H2/b9-7-,13-8+;;.
What are the key properties of (5Z)-N,N-dimethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-amine;ethane;ethene?
(5Z)-N,N-dimethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-amine;ethane;ethene has a molecular weight of 251.46 g/mol, XLogP of 5.23, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-N,N-dimethyl-5-[(Z)-prop-1-enyl]octa-5,7-dien-2-amine;ethane;ethene is sourced from PubChem (CID 142048312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).