C12H26N2 — CID 142048344
(5Z)-3-N,3-N-dimethylocta-1,5-diene-3,4-diamine;ethane (PubChem CID 142048344) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is (5Z)-3-N,3-N-dimethylocta-1,5-diene-3,4-diamine;ethane.
| Compound Name | (5Z)-3-N,3-N-dimethylocta-1,5-diene-3,4-diamine;ethane |
|---|---|
| PubChem CID | 142048344 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | (5Z)-3-N,3-N-dimethylocta-1,5-diene-3,4-diamine;ethane |
| SMILES | C=CC(C(N)/C=C\CC)N(C)C.CC |
| InChI | InChI=1S/C10H20N2.C2H6/c1-5-7-8-9(11)10(6-2)12(3)4;1-2/h6-10H,2,5,11H2,1,3-4H3;1-2H3/b8-7-; |
| InChIKey | RGKZEOOQYBUVKH-CFYXSCKTSA-N |
| XLogP | 2.42 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|