About 1-(2-ethylcyclobutyl)-3,5-dimethyl-2-methyliminoocta-5,7-dien-1-one
1-(2-ethylcyclobutyl)-3,5-dimethyl-2-methyliminoocta-5,7-dien-1-one (PubChem CID 142048419) has the molecular formula C17H27NO
and a molecular weight of 261.41 g/mol. Its IUPAC name is 1-(2-ethylcyclobutyl)-3,5-dimethyl-2-methyliminoocta-5,7-dien-1-one.
Molecular Properties
| Compound Name | 1-(2-ethylcyclobutyl)-3,5-dimethyl-2-methyliminoocta-5,7-dien-1-one |
| PubChem CID | 142048419 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 1-(2-ethylcyclobutyl)-3,5-dimethyl-2-methyliminoocta-5,7-dien-1-one |
| SMILES | C=CC=C(C)CC(C)/C(=N\C)C(=O)C1CCC1CC |
| InChI | InChI=1S/C17H27NO/c1-6-8-12(3)11-13(4)16(18-5)17(19)15-10-9-14(15)7-2/h6,8,13-15H,1,7,9-11H2,2-5H3/b12-8?,18-16+ |
| InChIKey | WVRKVBLJZWVCML-PEGMHEBYSA-N |
| XLogP | 4.22 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-ethylcyclobutyl)-3,5-dimethyl-2-methyliminoocta-5,7-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethylcyclobutyl)-3,5-dimethyl-2-methyliminoocta-5,7-dien-1-one?
The IUPAC name of 1-(2-ethylcyclobutyl)-3,5-dimethyl-2-methyliminoocta-5,7-dien-1-one (CID 142048419) is 1-(2-ethylcyclobutyl)-3,5-dimethyl-2-methyliminoocta-5,7-dien-1-one.
What is the SMILES notation for 1-(2-ethylcyclobutyl)-3,5-dimethyl-2-methyliminoocta-5,7-dien-1-one?
The canonical SMILES for 1-(2-ethylcyclobutyl)-3,5-dimethyl-2-methyliminoocta-5,7-dien-1-one is C=CC=C(C)CC(C)/C(=N\C)C(=O)C1CCC1CC.
What is the InChIKey of 1-(2-ethylcyclobutyl)-3,5-dimethyl-2-methyliminoocta-5,7-dien-1-one?
The InChIKey is WVRKVBLJZWVCML-PEGMHEBYSA-N. The full InChI is InChI=1S/C17H27NO/c1-6-8-12(3)11-13(4)16(18-5)17(19)15-10-9-14(15)7-2/h6,8,13-15H,1,7,9-11H2,2-5H3/b12-8?,18-16+.
What are the key properties of 1-(2-ethylcyclobutyl)-3,5-dimethyl-2-methyliminoocta-5,7-dien-1-one?
1-(2-ethylcyclobutyl)-3,5-dimethyl-2-methyliminoocta-5,7-dien-1-one has a molecular weight of 261.41 g/mol, XLogP of 4.22, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethylcyclobutyl)-3,5-dimethyl-2-methyliminoocta-5,7-dien-1-one is sourced from PubChem (CID 142048419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).