C13H25NO — CID 142048675
ethane;N-[(3Z,5Z)-4-methoxyhepta-1,3,5-trien-3-yl]methanimine (PubChem CID 142048675) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is ethane;N-[(3Z,5Z)-4-methoxyhepta-1,3,5-trien-3-yl]methanimine.
| Compound Name | ethane;N-[(3Z,5Z)-4-methoxyhepta-1,3,5-trien-3-yl]methanimine |
|---|---|
| PubChem CID | 142048675 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | ethane;N-[(3Z,5Z)-4-methoxyhepta-1,3,5-trien-3-yl]methanimine |
| SMILES | C=C/C(N=C)=C(\C=C/C)OC.CC.CC |
| InChI | InChI=1S/C9H13NO.2C2H6/c1-5-7-9(11-4)8(6-2)10-3;2*1-2/h5-7H,2-3H2,1,4H3;2*1-2H3/b7-5-,9-8-;; |
| InChIKey | WWSWTGHHSMYWTO-GJZKZAJYSA-N |
| XLogP | 4.36 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|