C9H13NO — CID 142048676
N-[(3Z,5Z)-4-methoxyhepta-1,3,5-trien-3-yl]methanimine (PubChem CID 142048676) has the molecular formula C9H13NO and a molecular weight of 151.21 g/mol. Its IUPAC name is N-[(3Z,5Z)-4-methoxyhepta-1,3,5-trien-3-yl]methanimine.
| Compound Name | N-[(3Z,5Z)-4-methoxyhepta-1,3,5-trien-3-yl]methanimine |
|---|---|
| PubChem CID | 142048676 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | N-[(3Z,5Z)-4-methoxyhepta-1,3,5-trien-3-yl]methanimine |
| SMILES | C=C/C(N=C)=C(\C=C/C)OC |
| InChI | InChI=1S/C9H13NO/c1-5-7-9(11-4)8(6-2)10-3/h5-7H,2-3H2,1,4H3/b7-5-,9-8- |
| InChIKey | GCIYMFVBLYNVTB-PJHABFGRSA-N |
| XLogP | 2.31 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|