About ethane;(2E,3E)-2-ethylidene-4-hydroxy-1-pyrrolidin-1-ylhexa-3,5-dien-1-one
ethane;(2E,3E)-2-ethylidene-4-hydroxy-1-pyrrolidin-1-ylhexa-3,5-dien-1-one (PubChem CID 142049116) has the molecular formula C14H23NO2
and a molecular weight of 237.34 g/mol. Its IUPAC name is ethane;(2E,3E)-2-ethylidene-4-hydroxy-1-pyrrolidin-1-ylhexa-3,5-dien-1-one.
Molecular Properties
| Compound Name | ethane;(2E,3E)-2-ethylidene-4-hydroxy-1-pyrrolidin-1-ylhexa-3,5-dien-1-one |
| PubChem CID | 142049116 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | ethane;(2E,3E)-2-ethylidene-4-hydroxy-1-pyrrolidin-1-ylhexa-3,5-dien-1-one |
| SMILES | C=C/C(O)=C\C(=C/C)C(=O)N1CCCC1.CC |
| InChI | InChI=1S/C12H17NO2.C2H6/c1-3-10(9-11(14)4-2)12(15)13-7-5-6-8-13;1-2/h3-4,9,14H,2,5-8H2,1H3;1-2H3/b10-3+,11-9+; |
| InChIKey | GFCOOEYKSMBLIG-JCMMMSSJSA-N |
| XLogP | 3.21 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(2E,3E)-2-ethylidene-4-hydroxy-1-pyrrolidin-1-ylhexa-3,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(2E,3E)-2-ethylidene-4-hydroxy-1-pyrrolidin-1-ylhexa-3,5-dien-1-one?
The IUPAC name of ethane;(2E,3E)-2-ethylidene-4-hydroxy-1-pyrrolidin-1-ylhexa-3,5-dien-1-one (CID 142049116) is ethane;(2E,3E)-2-ethylidene-4-hydroxy-1-pyrrolidin-1-ylhexa-3,5-dien-1-one.
What is the SMILES notation for ethane;(2E,3E)-2-ethylidene-4-hydroxy-1-pyrrolidin-1-ylhexa-3,5-dien-1-one?
The canonical SMILES for ethane;(2E,3E)-2-ethylidene-4-hydroxy-1-pyrrolidin-1-ylhexa-3,5-dien-1-one is C=C/C(O)=C\C(=C/C)C(=O)N1CCCC1.CC.
What is the InChIKey of ethane;(2E,3E)-2-ethylidene-4-hydroxy-1-pyrrolidin-1-ylhexa-3,5-dien-1-one?
The InChIKey is GFCOOEYKSMBLIG-JCMMMSSJSA-N. The full InChI is InChI=1S/C12H17NO2.C2H6/c1-3-10(9-11(14)4-2)12(15)13-7-5-6-8-13;1-2/h3-4,9,14H,2,5-8H2,1H3;1-2H3/b10-3+,11-9+;.
What are the key properties of ethane;(2E,3E)-2-ethylidene-4-hydroxy-1-pyrrolidin-1-ylhexa-3,5-dien-1-one?
ethane;(2E,3E)-2-ethylidene-4-hydroxy-1-pyrrolidin-1-ylhexa-3,5-dien-1-one has a molecular weight of 237.34 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(2E,3E)-2-ethylidene-4-hydroxy-1-pyrrolidin-1-ylhexa-3,5-dien-1-one is sourced from PubChem (CID 142049116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).