About 2-[2-(3-aminooxy-3-ethylpentoxy)-2-ethylbutoxy]-5-methyl-3,1-benzoxazin-4-one
2-[2-(3-aminooxy-3-ethylpentoxy)-2-ethylbutoxy]-5-methyl-3,1-benzoxazin-4-one (PubChem CID 142049158) has the molecular formula C22H34N2O5
and a molecular weight of 406.52 g/mol. Its IUPAC name is 2-[2-(3-aminooxy-3-ethylpentoxy)-2-ethylbutoxy]-5-methyl-3,1-benzoxazin-4-one.
Molecular Properties
| Compound Name | 2-[2-(3-aminooxy-3-ethylpentoxy)-2-ethylbutoxy]-5-methyl-3,1-benzoxazin-4-one |
| PubChem CID | 142049158 |
| Molecular Formula | C22H34N2O5 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 2-[2-(3-aminooxy-3-ethylpentoxy)-2-ethylbutoxy]-5-methyl-3,1-benzoxazin-4-one |
| SMILES | CCC(CC)(CCOC(CC)(CC)COc1nc2cccc(C)c2c(=O)o1)ON |
| InChI | InChI=1S/C22H34N2O5/c1-6-21(7-2,29-23)13-14-27-22(8-3,9-4)15-26-20-24-17-12-10-11-16(5)18(17)19(25)28-20/h10-12H,6-9,13-15,23H2,1-5H3 |
| InChIKey | YGZAESOPWWTJHD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(3-aminooxy-3-ethylpentoxy)-2-ethylbutoxy]-5-methyl-3,1-benzoxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3-aminooxy-3-ethylpentoxy)-2-ethylbutoxy]-5-methyl-3,1-benzoxazin-4-one?
The IUPAC name of 2-[2-(3-aminooxy-3-ethylpentoxy)-2-ethylbutoxy]-5-methyl-3,1-benzoxazin-4-one (CID 142049158) is 2-[2-(3-aminooxy-3-ethylpentoxy)-2-ethylbutoxy]-5-methyl-3,1-benzoxazin-4-one.
What is the SMILES notation for 2-[2-(3-aminooxy-3-ethylpentoxy)-2-ethylbutoxy]-5-methyl-3,1-benzoxazin-4-one?
The canonical SMILES for 2-[2-(3-aminooxy-3-ethylpentoxy)-2-ethylbutoxy]-5-methyl-3,1-benzoxazin-4-one is CCC(CC)(CCOC(CC)(CC)COc1nc2cccc(C)c2c(=O)o1)ON.
What is the InChIKey of 2-[2-(3-aminooxy-3-ethylpentoxy)-2-ethylbutoxy]-5-methyl-3,1-benzoxazin-4-one?
The InChIKey is YGZAESOPWWTJHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H34N2O5/c1-6-21(7-2,29-23)13-14-27-22(8-3,9-4)15-26-20-24-17-12-10-11-16(5)18(17)19(25)28-20/h10-12H,6-9,13-15,23H2,1-5H3.
What are the key properties of 2-[2-(3-aminooxy-3-ethylpentoxy)-2-ethylbutoxy]-5-methyl-3,1-benzoxazin-4-one?
2-[2-(3-aminooxy-3-ethylpentoxy)-2-ethylbutoxy]-5-methyl-3,1-benzoxazin-4-one has a molecular weight of 406.52 g/mol, XLogP of 4.29, 12 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-aminooxy-3-ethylpentoxy)-2-ethylbutoxy]-5-methyl-3,1-benzoxazin-4-one is sourced from PubChem (CID 142049158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).