C41H63NO3 — CID 142049522
ethyl 4-[2-[(E)-2-[2-[5-[[(2Z,4E)-hepta-2,4-dien-4-yl]amino]pentoxy]phenyl]ethenyl]-7-methyloctyl]benzoate;propane (PubChem CID 142049522) has the molecular formula C41H63NO3 and a molecular weight of 617.96 g/mol. Its IUPAC name is ethyl 4-[2-[(E)-2-[2-[5-[[(2Z,4E)-hepta-2,4-dien-4-yl]amino]pentoxy]phenyl]ethenyl]-7-methyloctyl]benzoate;propane.
| Compound Name | ethyl 4-[2-[(E)-2-[2-[5-[[(2Z,4E)-hepta-2,4-dien-4-yl]amino]pentoxy]phenyl]ethenyl]-7-methyloctyl]benzoate;propane |
|---|---|
| PubChem CID | 142049522 |
| Molecular Formula | C41H63NO3 |
| Molecular Weight | 617.96 g/mol |
| Exact Mass | 617.48 |
| IUPAC Name | ethyl 4-[2-[(E)-2-[2-[5-[[(2Z,4E)-hepta-2,4-dien-4-yl]amino]pentoxy]phenyl]ethenyl]-7-methyloctyl]benzoate;propane |
| SMILES | C/C=C\C(=C/CC)NCCCCCOc1ccccc1/C=C/C(CCCCC(C)C)Cc1ccc(C(=O)OCC)cc1.CCC |
| InChI | InChI=1S/C38H55NO3.C3H8/c1-6-16-36(17-7-2)39-28-14-9-15-29-42-37-21-13-12-20-34(37)25-22-32(19-11-10-18-31(4)5)30-33-23-26-35(27-24-33)38(40)41-8-3;1-3-2/h6,12-13,16-17,20-27,31-32,39H,7-11,14-15,18-19,28-30H2,1-5H3;3H2,1-2H3/b16-6-,25-22+,36-17+; |
| InChIKey | UJXKOIOPABJNNZ-QKROVLNASA-N |
| XLogP | 11.38 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.96 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|