C21H20F2N2O2S — CID 142050320
3-[3-[3-[(3,4-difluorophenyl)methylamino]propoxy]phenyl]-5-ethenyl-1,2-oxazole-4-thiol (PubChem CID 142050320) has the molecular formula C21H20F2N2O2S and a molecular weight of 402.47 g/mol. Its IUPAC name is 3-[3-[3-[(3,4-difluorophenyl)methylamino]propoxy]phenyl]-5-ethenyl-1,2-oxazole-4-thiol.
| Compound Name | 3-[3-[3-[(3,4-difluorophenyl)methylamino]propoxy]phenyl]-5-ethenyl-1,2-oxazole-4-thiol |
|---|---|
| PubChem CID | 142050320 |
| Molecular Formula | C21H20F2N2O2S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 3-[3-[3-[(3,4-difluorophenyl)methylamino]propoxy]phenyl]-5-ethenyl-1,2-oxazole-4-thiol |
| SMILES | C=Cc1onc(-c2cccc(OCCCNCc3ccc(F)c(F)c3)c2)c1S |
| InChI | InChI=1S/C21H20F2N2O2S/c1-2-19-21(28)20(25-27-19)15-5-3-6-16(12-15)26-10-4-9-24-13-14-7-8-17(22)18(23)11-14/h2-3,5-8,11-12,24,28H,1,4,9-10,13H2 |
| InChIKey | DCIBIDHLUCQQSB-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|