C17H14F6O6S2 — CID 14205044
[4-[1,1,1,3,3,3-hexafluoro-2-(4-methylsulfonyloxyphenyl)propan-2-yl]phenyl] methanesulfonate (PubChem CID 14205044) has the molecular formula C17H14F6O6S2 and a molecular weight of 492.42 g/mol. Its IUPAC name is [4-[1,1,1,3,3,3-hexafluoro-2-(4-methylsulfonyloxyphenyl)propan-2-yl]phenyl] methanesulfonate.
| Compound Name | [4-[1,1,1,3,3,3-hexafluoro-2-(4-methylsulfonyloxyphenyl)propan-2-yl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 14205044 |
| Molecular Formula | C17H14F6O6S2 |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 492.01 |
| IUPAC Name | [4-[1,1,1,3,3,3-hexafluoro-2-(4-methylsulfonyloxyphenyl)propan-2-yl]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(C(c2ccc(OS(C)(=O)=O)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F6O6S2/c1-30(24,25)28-13-7-3-11(4-8-13)15(16(18,19)20,17(21,22)23)12-5-9-14(10-6-12)29-31(2,26)27/h3-10H,1-2H3 |
| InChIKey | WCLFNEOODLYWBR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|