C11H19NO — CID 142050511
(3E,5Z)-3-methoxy-N,2-dimethylocta-3,5,7-trien-1-amine (PubChem CID 142050511) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (3E,5Z)-3-methoxy-N,2-dimethylocta-3,5,7-trien-1-amine.
| Compound Name | (3E,5Z)-3-methoxy-N,2-dimethylocta-3,5,7-trien-1-amine |
|---|---|
| PubChem CID | 142050511 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (3E,5Z)-3-methoxy-N,2-dimethylocta-3,5,7-trien-1-amine |
| SMILES | C=C/C=C\C=C(\OC)C(C)CNC |
| InChI | InChI=1S/C11H19NO/c1-5-6-7-8-11(13-4)10(2)9-12-3/h5-8,10,12H,1,9H2,2-4H3/b7-6-,11-8+ |
| InChIKey | QRAPZRBJNBOBFW-BQGCWICQSA-N |
| XLogP | 2.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|