C26H47NO — CID 142050554
6-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,3,7-trimethyl-5-[(Z)-prop-1-enyl]-3H-azepin-2-one;ethane (PubChem CID 142050554) has the molecular formula C26H47NO and a molecular weight of 389.67 g/mol. Its IUPAC name is 6-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,3,7-trimethyl-5-[(Z)-prop-1-enyl]-3H-azepin-2-one;ethane.
| Compound Name | 6-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,3,7-trimethyl-5-[(Z)-prop-1-enyl]-3H-azepin-2-one;ethane |
|---|---|
| PubChem CID | 142050554 |
| Molecular Formula | C26H47NO |
| Molecular Weight | 389.67 g/mol |
| Exact Mass | 389.37 |
| IUPAC Name | 6-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,3,7-trimethyl-5-[(Z)-prop-1-enyl]-3H-azepin-2-one;ethane |
| SMILES | C=C/C=C\C1=C(C)N(C)C(=O)C(C)C(C=C)=C1/C=C\C.CC.CC.CC.CC |
| InChI | InChI=1S/C18H23NO.4C2H6/c1-7-10-12-16-14(5)19(6)18(20)13(4)15(9-3)17(16)11-8-2;4*1-2/h7-13H,1,3H2,2,4-6H3;4*1-2H3/b11-8-,12-10-;;;; |
| InChIKey | GVJLFCHFSFVWJK-JSVSETHCSA-N |
| XLogP | 8.27 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.67 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|