About 5-methyl-3,4-dihydro-2H-pyrrole;N-methyl-N-prop-1-en-2-ylbutan-1-amine
5-methyl-3,4-dihydro-2H-pyrrole;N-methyl-N-prop-1-en-2-ylbutan-1-amine (PubChem CID 142050772) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is 5-methyl-3,4-dihydro-2H-pyrrole;N-methyl-N-prop-1-en-2-ylbutan-1-amine.
Molecular Properties
| Compound Name | 5-methyl-3,4-dihydro-2H-pyrrole;N-methyl-N-prop-1-en-2-ylbutan-1-amine |
| PubChem CID | 142050772 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 5-methyl-3,4-dihydro-2H-pyrrole;N-methyl-N-prop-1-en-2-ylbutan-1-amine |
| SMILES | C=C(C)N(C)CCCC.CC1=NCCC1 |
| InChI | InChI=1S/C8H17N.C5H9N/c1-5-6-7-9(4)8(2)3;1-5-3-2-4-6-5/h2,5-7H2,1,3-4H3;2-4H2,1H3 |
| InChIKey | UTPFQORDIXCHPK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-3,4-dihydro-2H-pyrrole;N-methyl-N-prop-1-en-2-ylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3,4-dihydro-2H-pyrrole;N-methyl-N-prop-1-en-2-ylbutan-1-amine?
The IUPAC name of 5-methyl-3,4-dihydro-2H-pyrrole;N-methyl-N-prop-1-en-2-ylbutan-1-amine (CID 142050772) is 5-methyl-3,4-dihydro-2H-pyrrole;N-methyl-N-prop-1-en-2-ylbutan-1-amine.
What is the SMILES notation for 5-methyl-3,4-dihydro-2H-pyrrole;N-methyl-N-prop-1-en-2-ylbutan-1-amine?
The canonical SMILES for 5-methyl-3,4-dihydro-2H-pyrrole;N-methyl-N-prop-1-en-2-ylbutan-1-amine is C=C(C)N(C)CCCC.CC1=NCCC1.
What is the InChIKey of 5-methyl-3,4-dihydro-2H-pyrrole;N-methyl-N-prop-1-en-2-ylbutan-1-amine?
The InChIKey is UTPFQORDIXCHPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C5H9N/c1-5-6-7-9(4)8(2)3;1-5-3-2-4-6-5/h2,5-7H2,1,3-4H3;2-4H2,1H3.
What are the key properties of 5-methyl-3,4-dihydro-2H-pyrrole;N-methyl-N-prop-1-en-2-ylbutan-1-amine?
5-methyl-3,4-dihydro-2H-pyrrole;N-methyl-N-prop-1-en-2-ylbutan-1-amine has a molecular weight of 210.36 g/mol, XLogP of 3.49, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3,4-dihydro-2H-pyrrole;N-methyl-N-prop-1-en-2-ylbutan-1-amine is sourced from PubChem (CID 142050772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).