About 6-bromo-7-fluoro-N',3-dimethylnaphthalene-2-carboximidamide
6-bromo-7-fluoro-N',3-dimethylnaphthalene-2-carboximidamide (PubChem CID 142050931) has the molecular formula C13H12BrFN2
and a molecular weight of 295.16 g/mol. Its IUPAC name is 6-bromo-7-fluoro-N',3-dimethylnaphthalene-2-carboximidamide.
Molecular Properties
| Compound Name | 6-bromo-7-fluoro-N',3-dimethylnaphthalene-2-carboximidamide |
| PubChem CID | 142050931 |
| Molecular Formula | C13H12BrFN2 |
| Molecular Weight | 295.16 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 6-bromo-7-fluoro-N',3-dimethylnaphthalene-2-carboximidamide |
| SMILES | C/N=C(\N)c1cc2cc(F)c(Br)cc2cc1C |
| InChI | InChI=1S/C13H12BrFN2/c1-7-3-8-5-11(14)12(15)6-9(8)4-10(7)13(16)17-2/h3-6H,1-2H3,(H2,16,17) |
| InChIKey | LMPIXFHWPKZQMJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.16 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-7-fluoro-N',3-dimethylnaphthalene-2-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-7-fluoro-N',3-dimethylnaphthalene-2-carboximidamide?
The IUPAC name of 6-bromo-7-fluoro-N',3-dimethylnaphthalene-2-carboximidamide (CID 142050931) is 6-bromo-7-fluoro-N',3-dimethylnaphthalene-2-carboximidamide.
What is the SMILES notation for 6-bromo-7-fluoro-N',3-dimethylnaphthalene-2-carboximidamide?
The canonical SMILES for 6-bromo-7-fluoro-N',3-dimethylnaphthalene-2-carboximidamide is C/N=C(\N)c1cc2cc(F)c(Br)cc2cc1C.
What is the InChIKey of 6-bromo-7-fluoro-N',3-dimethylnaphthalene-2-carboximidamide?
The InChIKey is LMPIXFHWPKZQMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrFN2/c1-7-3-8-5-11(14)12(15)6-9(8)4-10(7)13(16)17-2/h3-6H,1-2H3,(H2,16,17).
What are the key properties of 6-bromo-7-fluoro-N',3-dimethylnaphthalene-2-carboximidamide?
6-bromo-7-fluoro-N',3-dimethylnaphthalene-2-carboximidamide has a molecular weight of 295.16 g/mol, XLogP of 3.38, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-7-fluoro-N',3-dimethylnaphthalene-2-carboximidamide is sourced from PubChem (CID 142050931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).