About 2,2-dimethylthiepane;6-methyl-3,4-dihydro-2H-pyran
2,2-dimethylthiepane;6-methyl-3,4-dihydro-2H-pyran (PubChem CID 142050979) has the molecular formula C14H26OS
and a molecular weight of 242.43 g/mol. Its IUPAC name is 2,2-dimethylthiepane;6-methyl-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 2,2-dimethylthiepane;6-methyl-3,4-dihydro-2H-pyran |
| PubChem CID | 142050979 |
| Molecular Formula | C14H26OS |
| Molecular Weight | 242.43 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 2,2-dimethylthiepane;6-methyl-3,4-dihydro-2H-pyran |
| SMILES | CC1(C)CCCCCS1.CC1=CCCCO1 |
| InChI | InChI=1S/C8H16S.C6H10O/c1-8(2)6-4-3-5-7-9-8;1-6-4-2-3-5-7-6/h3-7H2,1-2H3;4H,2-3,5H2,1H3 |
| InChIKey | WUWNFQQLCQHSPW-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethylthiepane;6-methyl-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylthiepane;6-methyl-3,4-dihydro-2H-pyran?
The IUPAC name of 2,2-dimethylthiepane;6-methyl-3,4-dihydro-2H-pyran (CID 142050979) is 2,2-dimethylthiepane;6-methyl-3,4-dihydro-2H-pyran.
What is the SMILES notation for 2,2-dimethylthiepane;6-methyl-3,4-dihydro-2H-pyran?
The canonical SMILES for 2,2-dimethylthiepane;6-methyl-3,4-dihydro-2H-pyran is CC1(C)CCCCCS1.CC1=CCCCO1.
What is the InChIKey of 2,2-dimethylthiepane;6-methyl-3,4-dihydro-2H-pyran?
The InChIKey is WUWNFQQLCQHSPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16S.C6H10O/c1-8(2)6-4-3-5-7-9-8;1-6-4-2-3-5-7-6/h3-7H2,1-2H3;4H,2-3,5H2,1H3.
What are the key properties of 2,2-dimethylthiepane;6-methyl-3,4-dihydro-2H-pyran?
2,2-dimethylthiepane;6-methyl-3,4-dihydro-2H-pyran has a molecular weight of 242.43 g/mol, XLogP of 4.77, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylthiepane;6-methyl-3,4-dihydro-2H-pyran is sourced from PubChem (CID 142050979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).