About (2-methyl-5,6-dihydro-4H-pyrimidin-1-yl) thiohypofluorite
(2-methyl-5,6-dihydro-4H-pyrimidin-1-yl) thiohypofluorite (PubChem CID 142051036) has the molecular formula C5H9FN2S
and a molecular weight of 148.21 g/mol. Its IUPAC name is (2-methyl-5,6-dihydro-4H-pyrimidin-1-yl) thiohypofluorite.
Molecular Properties
| Compound Name | (2-methyl-5,6-dihydro-4H-pyrimidin-1-yl) thiohypofluorite |
| PubChem CID | 142051036 |
| Molecular Formula | C5H9FN2S |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | (2-methyl-5,6-dihydro-4H-pyrimidin-1-yl) thiohypofluorite |
| SMILES | CC1=NCCCN1SF |
| InChI | InChI=1S/C5H9FN2S/c1-5-7-3-2-4-8(5)9-6/h2-4H2,1H3 |
| InChIKey | QDTGUELONUAWMP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-5,6-dihydro-4H-pyrimidin-1-yl) thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-5,6-dihydro-4H-pyrimidin-1-yl) thiohypofluorite?
The IUPAC name of (2-methyl-5,6-dihydro-4H-pyrimidin-1-yl) thiohypofluorite (CID 142051036) is (2-methyl-5,6-dihydro-4H-pyrimidin-1-yl) thiohypofluorite.
What is the SMILES notation for (2-methyl-5,6-dihydro-4H-pyrimidin-1-yl) thiohypofluorite?
The canonical SMILES for (2-methyl-5,6-dihydro-4H-pyrimidin-1-yl) thiohypofluorite is CC1=NCCCN1SF.
What is the InChIKey of (2-methyl-5,6-dihydro-4H-pyrimidin-1-yl) thiohypofluorite?
The InChIKey is QDTGUELONUAWMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9FN2S/c1-5-7-3-2-4-8(5)9-6/h2-4H2,1H3.
What are the key properties of (2-methyl-5,6-dihydro-4H-pyrimidin-1-yl) thiohypofluorite?
(2-methyl-5,6-dihydro-4H-pyrimidin-1-yl) thiohypofluorite has a molecular weight of 148.21 g/mol, XLogP of 1.64, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-5,6-dihydro-4H-pyrimidin-1-yl) thiohypofluorite is sourced from PubChem (CID 142051036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).