About 1-ethyl-7-methyl-2,3,4,5-tetrahydroazepine
1-ethyl-7-methyl-2,3,4,5-tetrahydroazepine (PubChem CID 142051084) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 1-ethyl-7-methyl-2,3,4,5-tetrahydroazepine.
Molecular Properties
| Compound Name | 1-ethyl-7-methyl-2,3,4,5-tetrahydroazepine |
| PubChem CID | 142051084 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 1-ethyl-7-methyl-2,3,4,5-tetrahydroazepine |
| SMILES | CCN1CCCCC=C1C |
| InChI | InChI=1S/C9H17N/c1-3-10-8-6-4-5-7-9(10)2/h7H,3-6,8H2,1-2H3 |
| InChIKey | UZLOGRKONGEUMN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethyl-7-methyl-2,3,4,5-tetrahydroazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-7-methyl-2,3,4,5-tetrahydroazepine?
The IUPAC name of 1-ethyl-7-methyl-2,3,4,5-tetrahydroazepine (CID 142051084) is 1-ethyl-7-methyl-2,3,4,5-tetrahydroazepine.
What is the SMILES notation for 1-ethyl-7-methyl-2,3,4,5-tetrahydroazepine?
The canonical SMILES for 1-ethyl-7-methyl-2,3,4,5-tetrahydroazepine is CCN1CCCCC=C1C.
What is the InChIKey of 1-ethyl-7-methyl-2,3,4,5-tetrahydroazepine?
The InChIKey is UZLOGRKONGEUMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-3-10-8-6-4-5-7-9(10)2/h7H,3-6,8H2,1-2H3.
What are the key properties of 1-ethyl-7-methyl-2,3,4,5-tetrahydroazepine?
1-ethyl-7-methyl-2,3,4,5-tetrahydroazepine has a molecular weight of 139.24 g/mol, XLogP of 2.40, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-7-methyl-2,3,4,5-tetrahydroazepine is sourced from PubChem (CID 142051084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).