About N-but-1-en-2-ylbutan-1-amine;ethane;ethanethiol
N-but-1-en-2-ylbutan-1-amine;ethane;ethanethiol (PubChem CID 142051155) has the molecular formula C12H29NS
and a molecular weight of 219.44 g/mol. Its IUPAC name is N-but-1-en-2-ylbutan-1-amine;ethane;ethanethiol.
Molecular Properties
| Compound Name | N-but-1-en-2-ylbutan-1-amine;ethane;ethanethiol |
| PubChem CID | 142051155 |
| Molecular Formula | C12H29NS |
| Molecular Weight | 219.44 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | N-but-1-en-2-ylbutan-1-amine;ethane;ethanethiol |
| SMILES | C=C(CC)NCCCC.CC.CCS |
| InChI | InChI=1S/C8H17N.C2H6S.C2H6/c1-4-6-7-9-8(3)5-2;1-2-3;1-2/h9H,3-7H2,1-2H3;3H,2H2,1H3;1-2H3 |
| InChIKey | CHCIKENUZDGUJA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-but-1-en-2-ylbutan-1-amine;ethane;ethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-but-1-en-2-ylbutan-1-amine;ethane;ethanethiol?
The IUPAC name of N-but-1-en-2-ylbutan-1-amine;ethane;ethanethiol (CID 142051155) is N-but-1-en-2-ylbutan-1-amine;ethane;ethanethiol.
What is the SMILES notation for N-but-1-en-2-ylbutan-1-amine;ethane;ethanethiol?
The canonical SMILES for N-but-1-en-2-ylbutan-1-amine;ethane;ethanethiol is C=C(CC)NCCCC.CC.CCS.
What is the InChIKey of N-but-1-en-2-ylbutan-1-amine;ethane;ethanethiol?
The InChIKey is CHCIKENUZDGUJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C2H6S.C2H6/c1-4-6-7-9-8(3)5-2;1-2-3;1-2/h9H,3-7H2,1-2H3;3H,2H2,1H3;1-2H3.
What are the key properties of N-but-1-en-2-ylbutan-1-amine;ethane;ethanethiol?
N-but-1-en-2-ylbutan-1-amine;ethane;ethanethiol has a molecular weight of 219.44 g/mol, XLogP of 4.26, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-but-1-en-2-ylbutan-1-amine;ethane;ethanethiol is sourced from PubChem (CID 142051155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).