About acetonitrile;N,1-dimethylcyclohexan-1-amine;ethane
acetonitrile;N,1-dimethylcyclohexan-1-amine;ethane (PubChem CID 142051471) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is acetonitrile;N,1-dimethylcyclohexan-1-amine;ethane.
Molecular Properties
| Compound Name | acetonitrile;N,1-dimethylcyclohexan-1-amine;ethane |
| PubChem CID | 142051471 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | acetonitrile;N,1-dimethylcyclohexan-1-amine;ethane |
| SMILES | CC.CC#N.CNC1(C)CCCCC1 |
| InChI | InChI=1S/C8H17N.C2H3N.C2H6/c1-8(9-2)6-4-3-5-7-8;1-2-3;1-2/h9H,3-7H2,1-2H3;1H3;1-2H3 |
| InChIKey | MZOKGYLOXCRYJW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetonitrile;N,1-dimethylcyclohexan-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;N,1-dimethylcyclohexan-1-amine;ethane?
The IUPAC name of acetonitrile;N,1-dimethylcyclohexan-1-amine;ethane (CID 142051471) is acetonitrile;N,1-dimethylcyclohexan-1-amine;ethane.
What is the SMILES notation for acetonitrile;N,1-dimethylcyclohexan-1-amine;ethane?
The canonical SMILES for acetonitrile;N,1-dimethylcyclohexan-1-amine;ethane is CC.CC#N.CNC1(C)CCCCC1.
What is the InChIKey of acetonitrile;N,1-dimethylcyclohexan-1-amine;ethane?
The InChIKey is MZOKGYLOXCRYJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C2H3N.C2H6/c1-8(9-2)6-4-3-5-7-8;1-2-3;1-2/h9H,3-7H2,1-2H3;1H3;1-2H3.
What are the key properties of acetonitrile;N,1-dimethylcyclohexan-1-amine;ethane?
acetonitrile;N,1-dimethylcyclohexan-1-amine;ethane has a molecular weight of 198.35 g/mol, XLogP of 3.48, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;N,1-dimethylcyclohexan-1-amine;ethane is sourced from PubChem (CID 142051471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).