C15H23NS — CID 142051518
(Z,7E)-6,6-dimethyl-7-(2-methylbutylidene)-N-methylsulfanylcyclohepta-2,4-dien-1-imine (PubChem CID 142051518) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is (Z,7E)-6,6-dimethyl-7-(2-methylbutylidene)-N-methylsulfanylcyclohepta-2,4-dien-1-imine.
| Compound Name | (Z,7E)-6,6-dimethyl-7-(2-methylbutylidene)-N-methylsulfanylcyclohepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142051518 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | (Z,7E)-6,6-dimethyl-7-(2-methylbutylidene)-N-methylsulfanylcyclohepta-2,4-dien-1-imine |
| SMILES | CCC(C)/C=C1C(=N\SC)/C=CC=CC/1(C)C |
| InChI | InChI=1S/C15H23NS/c1-6-12(2)11-13-14(16-17-5)9-7-8-10-15(13,3)4/h7-12H,6H2,1-5H3/b13-11-,16-14- |
| InChIKey | IPRYURUNYQHONN-IEFDFHFWSA-N |
| XLogP | 4.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|