C11H23FN2 — CID 142051535
7-fluoro-2,3,4,4,5-pentamethylazepan-3-amine (PubChem CID 142051535) has the molecular formula C11H23FN2 and a molecular weight of 202.32 g/mol. Its IUPAC name is 7-fluoro-2,3,4,4,5-pentamethylazepan-3-amine.
| Compound Name | 7-fluoro-2,3,4,4,5-pentamethylazepan-3-amine |
|---|---|
| PubChem CID | 142051535 |
| Molecular Formula | C11H23FN2 |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.18 |
| IUPAC Name | 7-fluoro-2,3,4,4,5-pentamethylazepan-3-amine |
| SMILES | CC1CC(F)NC(C)C(C)(N)C1(C)C |
| InChI | InChI=1S/C11H23FN2/c1-7-6-9(12)14-8(2)11(5,13)10(7,3)4/h7-9,14H,6,13H2,1-5H3 |
| InChIKey | OQVGCMGDZCZMKL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|