About ethane;1,4,5-trimethyl-3,6-dihydro-2H-pyridine
ethane;1,4,5-trimethyl-3,6-dihydro-2H-pyridine (PubChem CID 142051654) has the molecular formula C10H21N
and a molecular weight of 155.28 g/mol. Its IUPAC name is ethane;1,4,5-trimethyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | ethane;1,4,5-trimethyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 142051654 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | ethane;1,4,5-trimethyl-3,6-dihydro-2H-pyridine |
| SMILES | CC.CC1=C(C)CN(C)CC1 |
| InChI | InChI=1S/C8H15N.C2H6/c1-7-4-5-9(3)6-8(7)2;1-2/h4-6H2,1-3H3;1-2H3 |
| InChIKey | OQOZGVAUQWRFFL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1,4,5-trimethyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1,4,5-trimethyl-3,6-dihydro-2H-pyridine?
The IUPAC name of ethane;1,4,5-trimethyl-3,6-dihydro-2H-pyridine (CID 142051654) is ethane;1,4,5-trimethyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for ethane;1,4,5-trimethyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for ethane;1,4,5-trimethyl-3,6-dihydro-2H-pyridine is CC.CC1=C(C)CN(C)CC1.
What is the InChIKey of ethane;1,4,5-trimethyl-3,6-dihydro-2H-pyridine?
The InChIKey is OQOZGVAUQWRFFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N.C2H6/c1-7-4-5-9(3)6-8(7)2;1-2/h4-6H2,1-3H3;1-2H3.
What are the key properties of ethane;1,4,5-trimethyl-3,6-dihydro-2H-pyridine?
ethane;1,4,5-trimethyl-3,6-dihydro-2H-pyridine has a molecular weight of 155.28 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1,4,5-trimethyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 142051654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).