About 3-but-3-enyl-4-propylpyrrolidin-2-ol;(Z)-hept-3-enenitrile
3-but-3-enyl-4-propylpyrrolidin-2-ol;(Z)-hept-3-enenitrile (PubChem CID 142051753) has the molecular formula C18H32N2O
and a molecular weight of 292.47 g/mol. Its IUPAC name is 3-but-3-enyl-4-propylpyrrolidin-2-ol;(Z)-hept-3-enenitrile.
Molecular Properties
| Compound Name | 3-but-3-enyl-4-propylpyrrolidin-2-ol;(Z)-hept-3-enenitrile |
| PubChem CID | 142051753 |
| Molecular Formula | C18H32N2O |
| Molecular Weight | 292.47 g/mol |
| Exact Mass | 292.25 |
| IUPAC Name | 3-but-3-enyl-4-propylpyrrolidin-2-ol;(Z)-hept-3-enenitrile |
| SMILES | C=CCCC1C(CCC)CNC1O.CCC/C=C\CC#N |
| InChI | InChI=1S/C11H21NO.C7H11N/c1-3-5-7-10-9(6-4-2)8-12-11(10)13;1-2-3-4-5-6-7-8/h3,9-13H,1,4-8H2,2H3;4-5H,2-3,6H2,1H3/b;5-4- |
| InChIKey | RYJYWKRGMZQRMI-GUHKXDMSSA-N |
| XLogP | 4.16 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.47 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-but-3-enyl-4-propylpyrrolidin-2-ol;(Z)-hept-3-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-3-enyl-4-propylpyrrolidin-2-ol;(Z)-hept-3-enenitrile?
The IUPAC name of 3-but-3-enyl-4-propylpyrrolidin-2-ol;(Z)-hept-3-enenitrile (CID 142051753) is 3-but-3-enyl-4-propylpyrrolidin-2-ol;(Z)-hept-3-enenitrile.
What is the SMILES notation for 3-but-3-enyl-4-propylpyrrolidin-2-ol;(Z)-hept-3-enenitrile?
The canonical SMILES for 3-but-3-enyl-4-propylpyrrolidin-2-ol;(Z)-hept-3-enenitrile is C=CCCC1C(CCC)CNC1O.CCC/C=C\CC#N.
What is the InChIKey of 3-but-3-enyl-4-propylpyrrolidin-2-ol;(Z)-hept-3-enenitrile?
The InChIKey is RYJYWKRGMZQRMI-GUHKXDMSSA-N. The full InChI is InChI=1S/C11H21NO.C7H11N/c1-3-5-7-10-9(6-4-2)8-12-11(10)13;1-2-3-4-5-6-7-8/h3,9-13H,1,4-8H2,2H3;4-5H,2-3,6H2,1H3/b;5-4-.
What are the key properties of 3-but-3-enyl-4-propylpyrrolidin-2-ol;(Z)-hept-3-enenitrile?
3-but-3-enyl-4-propylpyrrolidin-2-ol;(Z)-hept-3-enenitrile has a molecular weight of 292.47 g/mol, XLogP of 4.16, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-3-enyl-4-propylpyrrolidin-2-ol;(Z)-hept-3-enenitrile is sourced from PubChem (CID 142051753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).