C7H10F3N — CID 142052023
(E)-5,5,5-trifluoro-3,4-dimethylpent-3-en-2-imine (PubChem CID 142052023) has the molecular formula C7H10F3N and a molecular weight of 165.16 g/mol. Its IUPAC name is (E)-5,5,5-trifluoro-3,4-dimethylpent-3-en-2-imine.
| Compound Name | (E)-5,5,5-trifluoro-3,4-dimethylpent-3-en-2-imine |
|---|---|
| PubChem CID | 142052023 |
| Molecular Formula | C7H10F3N |
| Molecular Weight | 165.16 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (E)-5,5,5-trifluoro-3,4-dimethylpent-3-en-2-imine |
| SMILES | [H]/N=C(C)/C(C)=C(\C)C(F)(F)F |
| InChI | InChI=1S/C7H10F3N/c1-4(6(3)11)5(2)7(8,9)10/h11H,1-3H3/b5-4+,11-6+ |
| InChIKey | FLNOQZCWQCFLDR-LJIKRCSCSA-N |
| XLogP | 2.92 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.16 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|