C22H35N3 — CID 142052418
N'-[(2Z,4Z,9E,11Z)-11-(2-aminoethyl)-9,10-dimethyl-7-prop-1-en-2-yltetradeca-2,4,9,11,13-pentaenyl]methanimidamide (PubChem CID 142052418) has the molecular formula C22H35N3 and a molecular weight of 341.54 g/mol. Its IUPAC name is N'-[(2Z,4Z,9E,11Z)-11-(2-aminoethyl)-9,10-dimethyl-7-prop-1-en-2-yltetradeca-2,4,9,11,13-pentaenyl]methanimidamide.
| Compound Name | N'-[(2Z,4Z,9E,11Z)-11-(2-aminoethyl)-9,10-dimethyl-7-prop-1-en-2-yltetradeca-2,4,9,11,13-pentaenyl]methanimidamide |
|---|---|
| PubChem CID | 142052418 |
| Molecular Formula | C22H35N3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | N'-[(2Z,4Z,9E,11Z)-11-(2-aminoethyl)-9,10-dimethyl-7-prop-1-en-2-yltetradeca-2,4,9,11,13-pentaenyl]methanimidamide |
| SMILES | C=C/C=C(CCN)\C(C)=C(/C)CC(C/C=C\C=C/C/N=C/N)C(=C)C |
| InChI | InChI=1S/C22H35N3/c1-6-11-21(13-14-23)20(5)19(4)16-22(18(2)3)12-9-7-8-10-15-25-17-24/h6-11,17,22H,1-2,12-16,23H2,3-5H3,(H2,24,25)/b9-7-,10-8-,20-19+,21-11- |
| InChIKey | XNIDCEJIVWLXIY-INVXPPJYSA-N |
| XLogP | 4.86 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|