About 1-ethenyl-4,5-dimethylpyrrolidin-2-one
1-ethenyl-4,5-dimethylpyrrolidin-2-one (PubChem CID 14205345) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 1-ethenyl-4,5-dimethylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-ethenyl-4,5-dimethylpyrrolidin-2-one |
| PubChem CID | 14205345 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 1-ethenyl-4,5-dimethylpyrrolidin-2-one |
| SMILES | C=CN1C(=O)CC(C)C1C |
| InChI | InChI=1S/C8H13NO/c1-4-9-7(3)6(2)5-8(9)10/h4,6-7H,1,5H2,2-3H3 |
| InChIKey | CRJHKHYPIUPQSX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethenyl-4,5-dimethylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-4,5-dimethylpyrrolidin-2-one?
The IUPAC name of 1-ethenyl-4,5-dimethylpyrrolidin-2-one (CID 14205345) is 1-ethenyl-4,5-dimethylpyrrolidin-2-one.
What is the SMILES notation for 1-ethenyl-4,5-dimethylpyrrolidin-2-one?
The canonical SMILES for 1-ethenyl-4,5-dimethylpyrrolidin-2-one is C=CN1C(=O)CC(C)C1C.
What is the InChIKey of 1-ethenyl-4,5-dimethylpyrrolidin-2-one?
The InChIKey is CRJHKHYPIUPQSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-4-9-7(3)6(2)5-8(9)10/h4,6-7H,1,5H2,2-3H3.
What are the key properties of 1-ethenyl-4,5-dimethylpyrrolidin-2-one?
1-ethenyl-4,5-dimethylpyrrolidin-2-one has a molecular weight of 139.20 g/mol, XLogP of 1.39, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-4,5-dimethylpyrrolidin-2-one is sourced from PubChem (CID 14205345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).