C12H25NO — CID 142053476
ethane;(2E,4E)-5-(methylamino)hepta-2,4,6-trien-3-ol (PubChem CID 142053476) has the molecular formula C12H25NO and a molecular weight of 199.34 g/mol. Its IUPAC name is ethane;(2E,4E)-5-(methylamino)hepta-2,4,6-trien-3-ol.
| Compound Name | ethane;(2E,4E)-5-(methylamino)hepta-2,4,6-trien-3-ol |
|---|---|
| PubChem CID | 142053476 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | ethane;(2E,4E)-5-(methylamino)hepta-2,4,6-trien-3-ol |
| SMILES | C=C/C(=C\C(O)=C/C)NC.CC.CC |
| InChI | InChI=1S/C8H13NO.2C2H6/c1-4-7(9-3)6-8(10)5-2;2*1-2/h4-6,9-10H,1H2,2-3H3;2*1-2H3/b7-6+,8-5+;; |
| InChIKey | UADMRUMMFIIONQ-JQDYITMPSA-N |
| XLogP | 3.79 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|