About benzene;N,N-dimethylcyclohexanamine
benzene;N,N-dimethylcyclohexanamine (PubChem CID 142054055) has the molecular formula C14H23N
and a molecular weight of 205.35 g/mol. Its IUPAC name is benzene;N,N-dimethylcyclohexanamine.
Molecular Properties
| Compound Name | benzene;N,N-dimethylcyclohexanamine |
| PubChem CID | 142054055 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | benzene;N,N-dimethylcyclohexanamine |
| SMILES | CN(C)C1CCCCC1.c1ccccc1 |
| InChI | InChI=1S/C8H17N.C6H6/c1-9(2)8-6-4-3-5-7-8;1-2-4-6-5-3-1/h8H,3-7H2,1-2H3;1-6H |
| InChIKey | URIBVDQAMXHTHK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzene;N,N-dimethylcyclohexanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;N,N-dimethylcyclohexanamine?
The IUPAC name of benzene;N,N-dimethylcyclohexanamine (CID 142054055) is benzene;N,N-dimethylcyclohexanamine.
What is the SMILES notation for benzene;N,N-dimethylcyclohexanamine?
The canonical SMILES for benzene;N,N-dimethylcyclohexanamine is CN(C)C1CCCCC1.c1ccccc1.
What is the InChIKey of benzene;N,N-dimethylcyclohexanamine?
The InChIKey is URIBVDQAMXHTHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C6H6/c1-9(2)8-6-4-3-5-7-8;1-2-4-6-5-3-1/h8H,3-7H2,1-2H3;1-6H.
What are the key properties of benzene;N,N-dimethylcyclohexanamine?
benzene;N,N-dimethylcyclohexanamine has a molecular weight of 205.35 g/mol, XLogP of 3.57, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;N,N-dimethylcyclohexanamine is sourced from PubChem (CID 142054055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).