C25H28N4O — CID 142054129
3-[2-[4-benzyl-6-[(1Z,3Z)-1,4-diaminobuta-1,3-dienyl]-3-pyridinyl]ethynyl]-1-azabicyclo[2.2.2]octan-3-ol (PubChem CID 142054129) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is 3-[2-[4-benzyl-6-[(1Z,3Z)-1,4-diaminobuta-1,3-dienyl]-3-pyridinyl]ethynyl]-1-azabicyclo[2.2.2]octan-3-ol.
| Compound Name | 3-[2-[4-benzyl-6-[(1Z,3Z)-1,4-diaminobuta-1,3-dienyl]-3-pyridinyl]ethynyl]-1-azabicyclo[2.2.2]octan-3-ol |
|---|---|
| PubChem CID | 142054129 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | 3-[2-[4-benzyl-6-[(1Z,3Z)-1,4-diaminobuta-1,3-dienyl]-3-pyridinyl]ethynyl]-1-azabicyclo[2.2.2]octan-3-ol |
| SMILES | N/C=C\C=C(/N)c1cc(Cc2ccccc2)c(C#CC2(O)CN3CCC2CC3)cn1 |
| InChI | InChI=1S/C25H28N4O/c26-12-4-7-23(27)24-16-21(15-19-5-2-1-3-6-19)20(17-28-24)8-11-25(30)18-29-13-9-22(25)10-14-29/h1-7,12,16-17,22,30H,9-10,13-15,18,26-27H2/b12-4-,23-7- |
| InChIKey | FXAIVUZAVLCTPL-MXAVTIJRSA-N |
| XLogP | 2.25 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|