About methanamine;N'-methylethanimidamide;2-methylprop-1-ene
methanamine;N'-methylethanimidamide;2-methylprop-1-ene (PubChem CID 142054622) has the molecular formula C8H21N3
and a molecular weight of 159.28 g/mol. Its IUPAC name is methanamine;N'-methylethanimidamide;2-methylprop-1-ene.
Molecular Properties
| Compound Name | methanamine;N'-methylethanimidamide;2-methylprop-1-ene |
| PubChem CID | 142054622 |
| Molecular Formula | C8H21N3 |
| Molecular Weight | 159.28 g/mol |
| Exact Mass | 159.17 |
| IUPAC Name | methanamine;N'-methylethanimidamide;2-methylprop-1-ene |
| SMILES | C/N=C(\C)N.C=C(C)C.CN |
| InChI | InChI=1S/C4H8.C3H8N2.CH5N/c1-4(2)3;1-3(4)5-2;1-2/h1H2,2-3H3;1-2H3,(H2,4,5);2H2,1H3 |
| InChIKey | UHUCBZWZGHCKFU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methanamine;N'-methylethanimidamide;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;N'-methylethanimidamide;2-methylprop-1-ene?
The IUPAC name of methanamine;N'-methylethanimidamide;2-methylprop-1-ene (CID 142054622) is methanamine;N'-methylethanimidamide;2-methylprop-1-ene.
What is the SMILES notation for methanamine;N'-methylethanimidamide;2-methylprop-1-ene?
The canonical SMILES for methanamine;N'-methylethanimidamide;2-methylprop-1-ene is C/N=C(\C)N.C=C(C)C.CN.
What is the InChIKey of methanamine;N'-methylethanimidamide;2-methylprop-1-ene?
The InChIKey is UHUCBZWZGHCKFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8.C3H8N2.CH5N/c1-4(2)3;1-3(4)5-2;1-2/h1H2,2-3H3;1-2H3,(H2,4,5);2H2,1H3.
What are the key properties of methanamine;N'-methylethanimidamide;2-methylprop-1-ene?
methanamine;N'-methylethanimidamide;2-methylprop-1-ene has a molecular weight of 159.28 g/mol, XLogP of 1.15, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;N'-methylethanimidamide;2-methylprop-1-ene is sourced from PubChem (CID 142054622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).