C17H32U — CID 142054657
(Z)-6-ethyl-4,4,6,8-tetramethyl-5-methylidenedec-2-ene;uranium (PubChem CID 142054657) has the molecular formula C17H32U and a molecular weight of 474.47 g/mol. Its IUPAC name is (Z)-6-ethyl-4,4,6,8-tetramethyl-5-methylidenedec-2-ene;uranium.
| Compound Name | (Z)-6-ethyl-4,4,6,8-tetramethyl-5-methylidenedec-2-ene;uranium |
|---|---|
| PubChem CID | 142054657 |
| Molecular Formula | C17H32U |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | (Z)-6-ethyl-4,4,6,8-tetramethyl-5-methylidenedec-2-ene;uranium |
| SMILES | C=C(C(C)(C)/C=C\C)C(C)(CC)CC(C)CC.[U] |
| InChI | InChI=1S/C17H32.U/c1-9-12-16(6,7)15(5)17(8,11-3)13-14(4)10-2;/h9,12,14H,5,10-11,13H2,1-4,6-8H3;/b12-9-; |
| InChIKey | DGRYSHCQUAACMJ-MWMYENNMSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|