About ethane;2-hydrazinylbenzene-1,4-diamine
ethane;2-hydrazinylbenzene-1,4-diamine (PubChem CID 142054755) has the molecular formula C10H22N4
and a molecular weight of 198.31 g/mol. Its IUPAC name is ethane;2-hydrazinylbenzene-1,4-diamine.
Molecular Properties
| Compound Name | ethane;2-hydrazinylbenzene-1,4-diamine |
| PubChem CID | 142054755 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | ethane;2-hydrazinylbenzene-1,4-diamine |
| SMILES | CC.CC.NNc1cc(N)ccc1N |
| InChI | InChI=1S/C6H10N4.2C2H6/c7-4-1-2-5(8)6(3-4)10-9;2*1-2/h1-3,10H,7-9H2;2*1-2H3 |
| InChIKey | VMTYIYOTSZTDGF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 90.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-hydrazinylbenzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-hydrazinylbenzene-1,4-diamine?
The IUPAC name of ethane;2-hydrazinylbenzene-1,4-diamine (CID 142054755) is ethane;2-hydrazinylbenzene-1,4-diamine.
What is the SMILES notation for ethane;2-hydrazinylbenzene-1,4-diamine?
The canonical SMILES for ethane;2-hydrazinylbenzene-1,4-diamine is CC.CC.NNc1cc(N)ccc1N.
What is the InChIKey of ethane;2-hydrazinylbenzene-1,4-diamine?
The InChIKey is VMTYIYOTSZTDGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4.2C2H6/c7-4-1-2-5(8)6(3-4)10-9;2*1-2/h1-3,10H,7-9H2;2*1-2H3.
What are the key properties of ethane;2-hydrazinylbenzene-1,4-diamine?
ethane;2-hydrazinylbenzene-1,4-diamine has a molecular weight of 198.31 g/mol, XLogP of 2.19, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-hydrazinylbenzene-1,4-diamine is sourced from PubChem (CID 142054755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).