C18H40N2 — CID 142055313
ethane;methane;(6R,7S)-2,3,6,7-tetramethyl-2,3,6,7-tetrahydro-1H-pyrrolo[3,2-b]pyridine (PubChem CID 142055313) has the molecular formula C18H40N2 and a molecular weight of 284.53 g/mol. Its IUPAC name is ethane;methane;(6R,7S)-2,3,6,7-tetramethyl-2,3,6,7-tetrahydro-1H-pyrrolo[3,2-b]pyridine.
| Compound Name | ethane;methane;(6R,7S)-2,3,6,7-tetramethyl-2,3,6,7-tetrahydro-1H-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 142055313 |
| Molecular Formula | C18H40N2 |
| Molecular Weight | 284.53 g/mol |
| Exact Mass | 284.32 |
| IUPAC Name | ethane;methane;(6R,7S)-2,3,6,7-tetramethyl-2,3,6,7-tetrahydro-1H-pyrrolo[3,2-b]pyridine |
| SMILES | C.CC.CC.CC.CC1NC2=C(N=C[C@H](C)[C@@H]2C)C1C |
| InChI | InChI=1S/C11H18N2.3C2H6.CH4/c1-6-5-12-10-8(3)9(4)13-11(10)7(6)2;3*1-2;/h5-9,13H,1-4H3;3*1-2H3;1H4/t6-,7-,8?,9?;;;;/m0..../s1 |
| InChIKey | ALVBKAONWMPZCD-BPDPHKOKSA-N |
| XLogP | 5.90 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |