C12H14F2N2 — CID 142056167
(3Z)-3,4-difluoro-5-methylidene-6-(2-methylprop-2-enylideneamino)hepta-1,3,6-trien-2-amine (PubChem CID 142056167) has the molecular formula C12H14F2N2 and a molecular weight of 224.25 g/mol. Its IUPAC name is (3Z)-3,4-difluoro-5-methylidene-6-(2-methylprop-2-enylideneamino)hepta-1,3,6-trien-2-amine.
| Compound Name | (3Z)-3,4-difluoro-5-methylidene-6-(2-methylprop-2-enylideneamino)hepta-1,3,6-trien-2-amine |
|---|---|
| PubChem CID | 142056167 |
| Molecular Formula | C12H14F2N2 |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | (3Z)-3,4-difluoro-5-methylidene-6-(2-methylprop-2-enylideneamino)hepta-1,3,6-trien-2-amine |
| SMILES | C=C(C)/C=N/C(=C)C(=C)/C(F)=C(/F)C(=C)N |
| InChI | InChI=1S/C12H14F2N2/c1-7(2)6-16-10(5)8(3)11(13)12(14)9(4)15/h6H,1,3-5,15H2,2H3/b12-11-,16-6+ |
| InChIKey | RMEDDAGGHWFEOZ-CDIOEGICSA-N |
| XLogP | 3.33 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|