C16H24O2 — CID 142056537
2',2',5,5-tetramethylspiro[1,3-dioxane-2,6'-5,7-dihydro-4H-indene] (PubChem CID 142056537) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 2',2',5,5-tetramethylspiro[1,3-dioxane-2,6'-5,7-dihydro-4H-indene].
| Compound Name | 2',2',5,5-tetramethylspiro[1,3-dioxane-2,6'-5,7-dihydro-4H-indene] |
|---|---|
| PubChem CID | 142056537 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 2',2',5,5-tetramethylspiro[1,3-dioxane-2,6'-5,7-dihydro-4H-indene] |
| SMILES | CC1(C)C=C2CCC3(CC2=C1)OCC(C)(C)CO3 |
| InChI | InChI=1S/C16H24O2/c1-14(2)7-12-5-6-16(9-13(12)8-14)17-10-15(3,4)11-18-16/h7-8H,5-6,9-11H2,1-4H3 |
| InChIKey | KBSZTCAWJXMYAQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |